C19H23NO4 — CID 166293062
1-[(6,7-dimethoxynaphthalen-2-yl)methyl]piperidine-4-carboxylic acid (PubChem CID 166293062) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[(6,7-dimethoxynaphthalen-2-yl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(6,7-dimethoxynaphthalen-2-yl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 166293062 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 1-[(6,7-dimethoxynaphthalen-2-yl)methyl]piperidine-4-carboxylic acid |
| SMILES | COc1cc2ccc(CN3CCC(C(=O)O)CC3)cc2cc1OC |
| InChI | InChI=1S/C19H23NO4/c1-23-17-10-15-4-3-13(9-16(15)11-18(17)24-2)12-20-7-5-14(6-8-20)19(21)22/h3-4,9-11,14H,5-8,12H2,1-2H3,(H,21,22) |
| InChIKey | FAZMSNATNZIJEY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |