C28H34ClNO3 — CID 66852965
1-[[6-(5-phenylpentoxy)naphthalen-2-yl]methyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 66852965) has the molecular formula C28H34ClNO3 and a molecular weight of 468.04 g/mol. Its IUPAC name is 1-[[6-(5-phenylpentoxy)naphthalen-2-yl]methyl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[[6-(5-phenylpentoxy)naphthalen-2-yl]methyl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 66852965 |
| Molecular Formula | C28H34ClNO3 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-[[6-(5-phenylpentoxy)naphthalen-2-yl]methyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCN(Cc2ccc3cc(OCCCCCc4ccccc4)ccc3c2)CC1 |
| InChI | InChI=1S/C28H33NO3.ClH/c30-28(31)24-14-16-29(17-15-24)21-23-10-11-26-20-27(13-12-25(26)19-23)32-18-6-2-5-9-22-7-3-1-4-8-22;/h1,3-4,7-8,10-13,19-20,24H,2,5-6,9,14-18,21H2,(H,30,31);1H |
| InChIKey | BLNXSKJZOYCBAF-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|