C24H30ClNO3 — CID 66852517
1-[(E)-3-[4-(3-phenylpropoxy)phenyl]prop-2-enyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 66852517) has the molecular formula C24H30ClNO3 and a molecular weight of 415.96 g/mol. Its IUPAC name is 1-[(E)-3-[4-(3-phenylpropoxy)phenyl]prop-2-enyl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[(E)-3-[4-(3-phenylpropoxy)phenyl]prop-2-enyl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 66852517 |
| Molecular Formula | C24H30ClNO3 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-[(E)-3-[4-(3-phenylpropoxy)phenyl]prop-2-enyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCN(C/C=C/c2ccc(OCCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C24H29NO3.ClH/c26-24(27)22-14-17-25(18-15-22)16-4-8-21-10-12-23(13-11-21)28-19-5-9-20-6-2-1-3-7-20;/h1-4,6-8,10-13,22H,5,9,14-19H2,(H,26,27);1H/b8-4+; |
| InChIKey | HIOXNPBQHOSVIB-ZFXMFRGYSA-N |
| XLogP | 4.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|