C22H28N2O4 — CID 58723260
1-[2-[[6-(3-phenylpropoxy)-3-pyridinyl]oxy]ethyl]piperidine-4-carboxylic acid (PubChem CID 58723260) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[2-[[6-(3-phenylpropoxy)-3-pyridinyl]oxy]ethyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[[6-(3-phenylpropoxy)-3-pyridinyl]oxy]ethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 58723260 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-[2-[[6-(3-phenylpropoxy)-3-pyridinyl]oxy]ethyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(CCOc2ccc(OCCCc3ccccc3)nc2)CC1 |
| InChI | InChI=1S/C22H28N2O4/c25-22(26)19-10-12-24(13-11-19)14-16-27-20-8-9-21(23-17-20)28-15-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-9,17,19H,4,7,10-16H2,(H,25,26) |
| InChIKey | VOAJHVVBQQKULY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|