C24H30FNO3 — CID 12852626
1-[4-[2-[2-(4-fluorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxylic acid (PubChem CID 12852626) has the molecular formula C24H30FNO3 and a molecular weight of 399.51 g/mol. Its IUPAC name is 1-[4-[2-[2-(4-fluorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-[2-[2-(4-fluorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12852626 |
| Molecular Formula | C24H30FNO3 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 1-[4-[2-[2-(4-fluorophenyl)ethyl]phenoxy]butyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(CCCCOc2ccccc2CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H30FNO3/c25-22-11-8-19(9-12-22)7-10-20-5-1-2-6-23(20)29-18-4-3-15-26-16-13-21(14-17-26)24(27)28/h1-2,5-6,8-9,11-12,21H,3-4,7,10,13-18H2,(H,27,28) |
| InChIKey | APVCOJFGLQVZIM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|