C36H45FN2O4 — CID 142049428
4-[2-[2-[2-[4-[4-(4-fluorophenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-7-oxoheptyl]benzoic acid (PubChem CID 142049428) has the molecular formula C36H45FN2O4 and a molecular weight of 588.76 g/mol. Its IUPAC name is 4-[2-[2-[2-[4-[4-(4-fluorophenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-7-oxoheptyl]benzoic acid.
| Compound Name | 4-[2-[2-[2-[4-[4-(4-fluorophenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-7-oxoheptyl]benzoic acid |
|---|---|
| PubChem CID | 142049428 |
| Molecular Formula | C36H45FN2O4 |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 588.34 |
| IUPAC Name | 4-[2-[2-[2-[4-[4-(4-fluorophenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-7-oxoheptyl]benzoic acid |
| SMILES | O=CCCCCC(CCc1ccccc1OCCCCN1CCN(c2ccc(F)cc2)CC1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C36H45FN2O4/c37-33-17-19-34(20-18-33)39-24-22-38(23-25-39)21-5-7-27-43-35-10-4-3-9-31(35)14-11-29(8-2-1-6-26-40)28-30-12-15-32(16-13-30)36(41)42/h3-4,9-10,12-13,15-20,26,29H,1-2,5-8,11,14,21-25,27-28H2,(H,41,42) |
| InChIKey | DKYDCUVBBBLRFH-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|