C37H48N2O5 — CID 59210772
4-[6-carboxy-2-[2-[2-[5-(4-phenylpiperazin-1-yl)pentoxy]phenyl]ethyl]hexyl]benzoic acid (PubChem CID 59210772) has the molecular formula C37H48N2O5 and a molecular weight of 600.80 g/mol. Its IUPAC name is 4-[6-carboxy-2-[2-[2-[5-(4-phenylpiperazin-1-yl)pentoxy]phenyl]ethyl]hexyl]benzoic acid.
| Compound Name | 4-[6-carboxy-2-[2-[2-[5-(4-phenylpiperazin-1-yl)pentoxy]phenyl]ethyl]hexyl]benzoic acid |
|---|---|
| PubChem CID | 59210772 |
| Molecular Formula | C37H48N2O5 |
| Molecular Weight | 600.80 g/mol |
| Exact Mass | 600.36 |
| IUPAC Name | 4-[6-carboxy-2-[2-[2-[5-(4-phenylpiperazin-1-yl)pentoxy]phenyl]ethyl]hexyl]benzoic acid |
| SMILES | O=C(O)CCCCC(CCc1ccccc1OCCCCCN1CCN(c2ccccc2)CC1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C37H48N2O5/c40-36(41)16-8-5-11-30(29-31-18-21-33(22-19-31)37(42)43)17-20-32-12-6-7-15-35(32)44-28-10-2-9-23-38-24-26-39(27-25-38)34-13-3-1-4-14-34/h1,3-4,6-7,12-15,18-19,21-22,30H,2,5,8-11,16-17,20,23-29H2,(H,40,41)(H,42,43) |
| InChIKey | XUNHIBVGLAMQGI-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.80 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|