C34H42O3S — CID 142049545
4-[8-methyl-1-[2-(5-phenylpentoxy)phenyl]non-8-en-3-yl]sulfanylbenzoic acid (PubChem CID 142049545) has the molecular formula C34H42O3S and a molecular weight of 530.77 g/mol. Its IUPAC name is 4-[8-methyl-1-[2-(5-phenylpentoxy)phenyl]non-8-en-3-yl]sulfanylbenzoic acid.
| Compound Name | 4-[8-methyl-1-[2-(5-phenylpentoxy)phenyl]non-8-en-3-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 142049545 |
| Molecular Formula | C34H42O3S |
| Molecular Weight | 530.77 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 4-[8-methyl-1-[2-(5-phenylpentoxy)phenyl]non-8-en-3-yl]sulfanylbenzoic acid |
| SMILES | C=C(C)CCCCC(CCc1ccccc1OCCCCCc1ccccc1)Sc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C34H42O3S/c1-27(2)13-8-10-18-31(38-32-24-21-30(22-25-32)34(35)36)23-20-29-17-9-11-19-33(29)37-26-12-4-7-16-28-14-5-3-6-15-28/h3,5-6,9,11,14-15,17,19,21-22,24-25,31H,1,4,7-8,10,12-13,16,18,20,23,26H2,2H3,(H,35,36) |
| InChIKey | VKYZRIATVOAHHS-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.77 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|