C38H40O5 — CID 68660886
4-[3-[(4-carboxyphenyl)methyl]-5-[2-(6-phenylhexoxy)phenyl]pent-4-enyl]benzoic acid (PubChem CID 68660886) has the molecular formula C38H40O5 and a molecular weight of 576.73 g/mol. Its IUPAC name is 4-[3-[(4-carboxyphenyl)methyl]-5-[2-(6-phenylhexoxy)phenyl]pent-4-enyl]benzoic acid.
| Compound Name | 4-[3-[(4-carboxyphenyl)methyl]-5-[2-(6-phenylhexoxy)phenyl]pent-4-enyl]benzoic acid |
|---|---|
| PubChem CID | 68660886 |
| Molecular Formula | C38H40O5 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | 4-[3-[(4-carboxyphenyl)methyl]-5-[2-(6-phenylhexoxy)phenyl]pent-4-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCC(C=Cc2ccccc2OCCCCCCc2ccccc2)Cc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C38H40O5/c39-37(40)34-23-17-30(18-24-34)15-16-31(28-32-20-25-35(26-21-32)38(41)42)19-22-33-13-7-8-14-36(33)43-27-9-2-1-4-10-29-11-5-3-6-12-29/h3,5-8,11-14,17-26,31H,1-2,4,9-10,15-16,27-28H2,(H,39,40)(H,41,42) |
| InChIKey | PESNGHGJNBFXIO-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|