C30H31BrO5 — CID 123773320
4-[5-[2-(3-bromopropoxy)phenyl]-3-[(4-methoxycarbonylphenyl)methyl]pent-4-enyl]benzoic acid (PubChem CID 123773320) has the molecular formula C30H31BrO5 and a molecular weight of 551.48 g/mol. Its IUPAC name is 4-[5-[2-(3-bromopropoxy)phenyl]-3-[(4-methoxycarbonylphenyl)methyl]pent-4-enyl]benzoic acid.
| Compound Name | 4-[5-[2-(3-bromopropoxy)phenyl]-3-[(4-methoxycarbonylphenyl)methyl]pent-4-enyl]benzoic acid |
|---|---|
| PubChem CID | 123773320 |
| Molecular Formula | C30H31BrO5 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 4-[5-[2-(3-bromopropoxy)phenyl]-3-[(4-methoxycarbonylphenyl)methyl]pent-4-enyl]benzoic acid |
| SMILES | COC(=O)c1ccc(CC(C=Cc2ccccc2OCCCBr)CCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H31BrO5/c1-35-30(34)27-17-12-24(13-18-27)21-23(8-7-22-9-15-26(16-10-22)29(32)33)11-14-25-5-2-3-6-28(25)36-20-4-19-31/h2-3,5-6,9-18,23H,4,7-8,19-21H2,1H3,(H,32,33) |
| InChIKey | GKEIVFFLIIYGGB-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|