C34H40O5 — CID 20764278
methyl 4-[6-methoxy-6-oxo-2-[(E)-2-[2-(5-phenylpentoxy)phenyl]ethenyl]hexyl]benzoate (PubChem CID 20764278) has the molecular formula C34H40O5 and a molecular weight of 528.69 g/mol. Its IUPAC name is methyl 4-[6-methoxy-6-oxo-2-[(E)-2-[2-(5-phenylpentoxy)phenyl]ethenyl]hexyl]benzoate.
| Compound Name | methyl 4-[6-methoxy-6-oxo-2-[(E)-2-[2-(5-phenylpentoxy)phenyl]ethenyl]hexyl]benzoate |
|---|---|
| PubChem CID | 20764278 |
| Molecular Formula | C34H40O5 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | methyl 4-[6-methoxy-6-oxo-2-[(E)-2-[2-(5-phenylpentoxy)phenyl]ethenyl]hexyl]benzoate |
| SMILES | COC(=O)CCCC(/C=C/c1ccccc1OCCCCCc1ccccc1)Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C34H40O5/c1-37-33(35)18-11-15-28(26-29-20-23-31(24-21-29)34(36)38-2)19-22-30-16-8-9-17-32(30)39-25-10-4-7-14-27-12-5-3-6-13-27/h3,5-6,8-9,12-13,16-17,19-24,28H,4,7,10-11,14-15,18,25-26H2,1-2H3/b22-19+ |
| InChIKey | XORSZCVWHFHZCG-ZBJSNUHESA-N |
| XLogP | 7.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|