C36H45NO5 — CID 59210742
ethyl 4-[7-ethoxy-7-oxo-2-[(E)-2-[3-(5-phenylpentoxy)-2-pyridinyl]ethenyl]heptyl]benzoate (PubChem CID 59210742) has the molecular formula C36H45NO5 and a molecular weight of 571.76 g/mol. Its IUPAC name is ethyl 4-[7-ethoxy-7-oxo-2-[(E)-2-[3-(5-phenylpentoxy)-2-pyridinyl]ethenyl]heptyl]benzoate.
| Compound Name | ethyl 4-[7-ethoxy-7-oxo-2-[(E)-2-[3-(5-phenylpentoxy)-2-pyridinyl]ethenyl]heptyl]benzoate |
|---|---|
| PubChem CID | 59210742 |
| Molecular Formula | C36H45NO5 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | ethyl 4-[7-ethoxy-7-oxo-2-[(E)-2-[3-(5-phenylpentoxy)-2-pyridinyl]ethenyl]heptyl]benzoate |
| SMILES | CCOC(=O)CCCCC(/C=C/c1ncccc1OCCCCCc1ccccc1)Cc1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C36H45NO5/c1-3-40-35(38)19-11-10-17-30(28-31-20-23-32(24-21-31)36(39)41-4-2)22-25-33-34(18-13-26-37-33)42-27-12-6-9-16-29-14-7-5-8-15-29/h5,7-8,13-15,18,20-26,30H,3-4,6,9-12,16-17,19,27-28H2,1-2H3/b25-22+ |
| InChIKey | JUQFQSPOXOONGV-YYDJUVGSSA-N |
| XLogP | 8.05 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|