C26H32O5 — CID 59210618
4-[2-[(E)-2-(2-butoxyphenyl)ethenyl]-6-carboxyhexyl]benzoic acid (PubChem CID 59210618) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-[2-[(E)-2-(2-butoxyphenyl)ethenyl]-6-carboxyhexyl]benzoic acid.
| Compound Name | 4-[2-[(E)-2-(2-butoxyphenyl)ethenyl]-6-carboxyhexyl]benzoic acid |
|---|---|
| PubChem CID | 59210618 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 4-[2-[(E)-2-(2-butoxyphenyl)ethenyl]-6-carboxyhexyl]benzoic acid |
| SMILES | CCCCOc1ccccc1/C=C/C(CCCCC(=O)O)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H32O5/c1-2-3-18-31-24-10-6-5-9-22(24)15-12-20(8-4-7-11-25(27)28)19-21-13-16-23(17-14-21)26(29)30/h5-6,9-10,12-17,20H,2-4,7-8,11,18-19H2,1H3,(H,27,28)(H,29,30)/b15-12+ |
| InChIKey | PZUMPBYBNPHEBZ-NTCAYCPXSA-N |
| XLogP | 6.08 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|