C34H42N2O5 — CID 72531568
4-[6-carboxy-2-[2-[2-[5-[methyl(pyridin-4-ylmethyl)amino]pentoxy]phenyl]ethenyl]hexyl]benzoic acid (PubChem CID 72531568) has the molecular formula C34H42N2O5 and a molecular weight of 558.72 g/mol. Its IUPAC name is 4-[6-carboxy-2-[2-[2-[5-[methyl(pyridin-4-ylmethyl)amino]pentoxy]phenyl]ethenyl]hexyl]benzoic acid.
| Compound Name | 4-[6-carboxy-2-[2-[2-[5-[methyl(pyridin-4-ylmethyl)amino]pentoxy]phenyl]ethenyl]hexyl]benzoic acid |
|---|---|
| PubChem CID | 72531568 |
| Molecular Formula | C34H42N2O5 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | 4-[6-carboxy-2-[2-[2-[5-[methyl(pyridin-4-ylmethyl)amino]pentoxy]phenyl]ethenyl]hexyl]benzoic acid |
| SMILES | CN(CCCCCOc1ccccc1C=CC(CCCCC(=O)O)Cc1ccc(C(=O)O)cc1)Cc1ccncc1 |
| InChI | InChI=1S/C34H42N2O5/c1-36(26-29-19-21-35-22-20-29)23-7-2-8-24-41-32-11-5-4-10-30(32)16-13-27(9-3-6-12-33(37)38)25-28-14-17-31(18-15-28)34(39)40/h4-5,10-11,13-22,27H,2-3,6-9,12,23-26H2,1H3,(H,37,38)(H,39,40) |
| InChIKey | RQWIQGMIHIHANS-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|