C32H36O5 — CID 68660820
4-[3-[(4-carboxyphenyl)methyl]-5-(2-hexoxyphenyl)pent-4-enyl]benzoic acid (PubChem CID 68660820) has the molecular formula C32H36O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is 4-[3-[(4-carboxyphenyl)methyl]-5-(2-hexoxyphenyl)pent-4-enyl]benzoic acid.
| Compound Name | 4-[3-[(4-carboxyphenyl)methyl]-5-(2-hexoxyphenyl)pent-4-enyl]benzoic acid |
|---|---|
| PubChem CID | 68660820 |
| Molecular Formula | C32H36O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 4-[3-[(4-carboxyphenyl)methyl]-5-(2-hexoxyphenyl)pent-4-enyl]benzoic acid |
| SMILES | CCCCCCOc1ccccc1C=CC(CCc1ccc(C(=O)O)cc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H36O5/c1-2-3-4-7-22-37-30-9-6-5-8-27(30)17-14-25(23-26-15-20-29(21-16-26)32(35)36)11-10-24-12-18-28(19-13-24)31(33)34/h5-6,8-9,12-21,25H,2-4,7,10-11,22-23H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | AJJQPIXYPPGGRU-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|