C36H41NO6 — CID 59437415
4-[(E)-3-[(4-carboxyphenyl)methyl]-5-[2-[5-(2-oxopiperidin-1-yl)pentoxy]phenyl]pent-4-enyl]benzoic acid (PubChem CID 59437415) has the molecular formula C36H41NO6 and a molecular weight of 583.73 g/mol. Its IUPAC name is 4-[(E)-3-[(4-carboxyphenyl)methyl]-5-[2-[5-(2-oxopiperidin-1-yl)pentoxy]phenyl]pent-4-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-[(4-carboxyphenyl)methyl]-5-[2-[5-(2-oxopiperidin-1-yl)pentoxy]phenyl]pent-4-enyl]benzoic acid |
|---|---|
| PubChem CID | 59437415 |
| Molecular Formula | C36H41NO6 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 4-[(E)-3-[(4-carboxyphenyl)methyl]-5-[2-[5-(2-oxopiperidin-1-yl)pentoxy]phenyl]pent-4-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCC(/C=C/c2ccccc2OCCCCCN2CCCCC2=O)Cc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C36H41NO6/c38-34-10-4-6-24-37(34)23-5-1-7-25-43-33-9-3-2-8-30(33)18-15-28(26-29-16-21-32(22-17-29)36(41)42)12-11-27-13-19-31(20-14-27)35(39)40/h2-3,8-9,13-22,28H,1,4-7,10-12,23-26H2,(H,39,40)(H,41,42)/b18-15+ |
| InChIKey | URXPWZXQJYIPSU-OBGWFSINSA-N |
| XLogP | 7.15 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|