C32H37NO5 — CID 68709405
4-[(Z)-2-[2-(carboxymethylamino)ethyl]-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoic acid (PubChem CID 68709405) has the molecular formula C32H37NO5 and a molecular weight of 515.65 g/mol. Its IUPAC name is 4-[(Z)-2-[2-(carboxymethylamino)ethyl]-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoic acid.
| Compound Name | 4-[(Z)-2-[2-(carboxymethylamino)ethyl]-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoic acid |
|---|---|
| PubChem CID | 68709405 |
| Molecular Formula | C32H37NO5 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | 4-[(Z)-2-[2-(carboxymethylamino)ethyl]-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoic acid |
| SMILES | O=C(O)CNCCC(/C=C\c1ccccc1OCCCCCc1ccccc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H37NO5/c34-31(35)24-33-21-20-27(23-26-15-18-29(19-16-26)32(36)37)14-17-28-12-6-7-13-30(28)38-22-8-2-5-11-25-9-3-1-4-10-25/h1,3-4,6-7,9-10,12-19,27,33H,2,5,8,11,20-24H2,(H,34,35)(H,36,37)/b17-14- |
| InChIKey | QJTXXAKMZWPEAW-VKAVYKQESA-N |
| XLogP | 6.11 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|