C31H35BrO3 — CID 68707204
methyl 4-[(Z)-2-(2-bromoethyl)-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoate (PubChem CID 68707204) has the molecular formula C31H35BrO3 and a molecular weight of 535.52 g/mol. Its IUPAC name is methyl 4-[(Z)-2-(2-bromoethyl)-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoate.
| Compound Name | methyl 4-[(Z)-2-(2-bromoethyl)-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoate |
|---|---|
| PubChem CID | 68707204 |
| Molecular Formula | C31H35BrO3 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | methyl 4-[(Z)-2-(2-bromoethyl)-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(/C=C\c2ccccc2OCCCCCc2ccccc2)CCBr)cc1 |
| InChI | InChI=1S/C31H35BrO3/c1-34-31(33)29-19-16-26(17-20-29)24-27(21-22-32)15-18-28-13-7-8-14-30(28)35-23-9-3-6-12-25-10-4-2-5-11-25/h2,4-5,7-8,10-11,13-20,27H,3,6,9,12,21-24H2,1H3/b18-15- |
| InChIKey | IQGVVNVXGUGIDG-SDXDJHTJSA-N |
| XLogP | 7.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|