C36H35NO3 — CID 59180536
methyl 4-[(E)-2-[2-(4-cyanophenyl)ethyl]-4-[2-(3-phenylpropoxy)phenyl]but-3-enyl]benzoate (PubChem CID 59180536) has the molecular formula C36H35NO3 and a molecular weight of 529.68 g/mol. Its IUPAC name is methyl 4-[(E)-2-[2-(4-cyanophenyl)ethyl]-4-[2-(3-phenylpropoxy)phenyl]but-3-enyl]benzoate.
| Compound Name | methyl 4-[(E)-2-[2-(4-cyanophenyl)ethyl]-4-[2-(3-phenylpropoxy)phenyl]but-3-enyl]benzoate |
|---|---|
| PubChem CID | 59180536 |
| Molecular Formula | C36H35NO3 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | methyl 4-[(E)-2-[2-(4-cyanophenyl)ethyl]-4-[2-(3-phenylpropoxy)phenyl]but-3-enyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(/C=C/c2ccccc2OCCCc2ccccc2)CCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C36H35NO3/c1-39-36(38)34-23-20-31(21-24-34)26-30(16-13-29-14-17-32(27-37)18-15-29)19-22-33-11-5-6-12-35(33)40-25-7-10-28-8-3-2-4-9-28/h2-6,8-9,11-12,14-15,17-24,30H,7,10,13,16,25-26H2,1H3/b22-19+ |
| InChIKey | ICKNQNQSNSQBTI-ZBJSNUHESA-N |
| XLogP | 7.86 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|