C37H39N3O2 — CID 67352260
4-[4-[2-[(4-tert-butylphenyl)methoxy]phenyl]-2-[2-(4-cyanophenyl)ethyl]but-3-enyl]benzohydrazide (PubChem CID 67352260) has the molecular formula C37H39N3O2 and a molecular weight of 557.74 g/mol. Its IUPAC name is 4-[4-[2-[(4-tert-butylphenyl)methoxy]phenyl]-2-[2-(4-cyanophenyl)ethyl]but-3-enyl]benzohydrazide.
| Compound Name | 4-[4-[2-[(4-tert-butylphenyl)methoxy]phenyl]-2-[2-(4-cyanophenyl)ethyl]but-3-enyl]benzohydrazide |
|---|---|
| PubChem CID | 67352260 |
| Molecular Formula | C37H39N3O2 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | 4-[4-[2-[(4-tert-butylphenyl)methoxy]phenyl]-2-[2-(4-cyanophenyl)ethyl]but-3-enyl]benzohydrazide |
| SMILES | CC(C)(C)c1ccc(COc2ccccc2C=CC(CCc2ccc(C#N)cc2)Cc2ccc(C(=O)NN)cc2)cc1 |
| InChI | InChI=1S/C37H39N3O2/c1-37(2,3)34-22-17-31(18-23-34)26-42-35-7-5-4-6-32(35)19-14-28(11-8-27-9-12-30(25-38)13-10-27)24-29-15-20-33(21-16-29)36(41)40-39/h4-7,9-10,12-23,28H,8,11,24,26,39H2,1-3H3,(H,40,41) |
| InChIKey | JRMGLNSWJHPNTE-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|