C35H42N4O3 — CID 69070133
methyl 4-[3-[2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(2H-tetrazol-5-yl)heptyl]benzoate (PubChem CID 69070133) has the molecular formula C35H42N4O3 and a molecular weight of 566.75 g/mol. Its IUPAC name is methyl 4-[3-[2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(2H-tetrazol-5-yl)heptyl]benzoate.
| Compound Name | methyl 4-[3-[2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(2H-tetrazol-5-yl)heptyl]benzoate |
|---|---|
| PubChem CID | 69070133 |
| Molecular Formula | C35H42N4O3 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | methyl 4-[3-[2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(2H-tetrazol-5-yl)heptyl]benzoate |
| SMILES | COC(=O)c1ccc(CCC(C=Cc2ccccc2OCc2ccc(C(C)(C)C)cc2)CCCCc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C35H42N4O3/c1-35(2,3)31-23-18-28(19-24-31)25-42-32-11-7-6-10-29(32)20-15-26(9-5-8-12-33-36-38-39-37-33)13-14-27-16-21-30(22-17-27)34(40)41-4/h6-7,10-11,15-24,26H,5,8-9,12-14,25H2,1-4H3,(H,36,37,38,39) |
| InChIKey | KTPHYPAYIJOXDE-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|