C35H42N4O2 — CID 143443681
1-[4-[3-[(E)-2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(2H-tetrazol-5-yl)heptyl]phenyl]ethanone (PubChem CID 143443681) has the molecular formula C35H42N4O2 and a molecular weight of 550.75 g/mol. Its IUPAC name is 1-[4-[3-[(E)-2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(2H-tetrazol-5-yl)heptyl]phenyl]ethanone.
| Compound Name | 1-[4-[3-[(E)-2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(2H-tetrazol-5-yl)heptyl]phenyl]ethanone |
|---|---|
| PubChem CID | 143443681 |
| Molecular Formula | C35H42N4O2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | 1-[4-[3-[(E)-2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(2H-tetrazol-5-yl)heptyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(CCC(/C=C/c2ccccc2OCc2ccc(C(C)(C)C)cc2)CCCCc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C35H42N4O2/c1-26(40)30-20-15-28(16-21-30)14-13-27(9-5-8-12-34-36-38-39-37-34)17-22-31-10-6-7-11-33(31)41-25-29-18-23-32(24-19-29)35(2,3)4/h6-7,10-11,15-24,27H,5,8-9,12-14,25H2,1-4H3,(H,36,37,38,39)/b22-17+ |
| InChIKey | STPYAISXOINIBI-OQKWZONESA-N |
| XLogP | 7.95 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|