C36H42N2O4 — CID 70313229
4-[3-[(E)-2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(5-oxo-1,4-dihydroimidazol-2-yl)heptyl]benzoic acid (PubChem CID 70313229) has the molecular formula C36H42N2O4 and a molecular weight of 566.74 g/mol. Its IUPAC name is 4-[3-[(E)-2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(5-oxo-1,4-dihydroimidazol-2-yl)heptyl]benzoic acid.
| Compound Name | 4-[3-[(E)-2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(5-oxo-1,4-dihydroimidazol-2-yl)heptyl]benzoic acid |
|---|---|
| PubChem CID | 70313229 |
| Molecular Formula | C36H42N2O4 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | 4-[3-[(E)-2-[2-[(4-tert-butylphenyl)methoxy]phenyl]ethenyl]-7-(5-oxo-1,4-dihydroimidazol-2-yl)heptyl]benzoic acid |
| SMILES | CC(C)(C)c1ccc(COc2ccccc2/C=C/C(CCCCC2=NCC(=O)N2)CCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C36H42N2O4/c1-36(2,3)31-22-17-28(18-23-31)25-42-32-10-6-5-9-29(32)19-14-26(8-4-7-11-33-37-24-34(39)38-33)12-13-27-15-20-30(21-16-27)35(40)41/h5-6,9-10,14-23,26H,4,7-8,11-13,24-25H2,1-3H3,(H,40,41)(H,37,38,39)/b19-14+ |
| InChIKey | AUTHCDXXUSQKPB-XMHGGMMESA-N |
| XLogP | 7.61 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|