C31H33BrO5 — CID 59437413
methyl 4-[(E)-5-[2-(3-bromopropoxy)phenyl]-3-[(4-methoxycarbonylphenyl)methyl]pent-4-enyl]benzoate (PubChem CID 59437413) has the molecular formula C31H33BrO5 and a molecular weight of 565.50 g/mol. Its IUPAC name is methyl 4-[(E)-5-[2-(3-bromopropoxy)phenyl]-3-[(4-methoxycarbonylphenyl)methyl]pent-4-enyl]benzoate.
| Compound Name | methyl 4-[(E)-5-[2-(3-bromopropoxy)phenyl]-3-[(4-methoxycarbonylphenyl)methyl]pent-4-enyl]benzoate |
|---|---|
| PubChem CID | 59437413 |
| Molecular Formula | C31H33BrO5 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | methyl 4-[(E)-5-[2-(3-bromopropoxy)phenyl]-3-[(4-methoxycarbonylphenyl)methyl]pent-4-enyl]benzoate |
| SMILES | COC(=O)c1ccc(CCC(/C=C/c2ccccc2OCCCBr)Cc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C31H33BrO5/c1-35-30(33)27-16-10-23(11-17-27)8-9-24(22-25-13-18-28(19-14-25)31(34)36-2)12-15-26-6-3-4-7-29(26)37-21-5-20-32/h3-4,6-7,10-19,24H,5,8-9,20-22H2,1-2H3/b15-12+ |
| InChIKey | DEPNVQONPHUJNT-NTCAYCPXSA-N |
| XLogP | 6.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|