C27H33BrO5 — CID 59210706
4-[2-[(E)-2-[2-(5-bromopentoxy)phenyl]ethenyl]-6-carboxyhexyl]benzoic acid (PubChem CID 59210706) has the molecular formula C27H33BrO5 and a molecular weight of 517.46 g/mol. Its IUPAC name is 4-[2-[(E)-2-[2-(5-bromopentoxy)phenyl]ethenyl]-6-carboxyhexyl]benzoic acid.
| Compound Name | 4-[2-[(E)-2-[2-(5-bromopentoxy)phenyl]ethenyl]-6-carboxyhexyl]benzoic acid |
|---|---|
| PubChem CID | 59210706 |
| Molecular Formula | C27H33BrO5 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 4-[2-[(E)-2-[2-(5-bromopentoxy)phenyl]ethenyl]-6-carboxyhexyl]benzoic acid |
| SMILES | O=C(O)CCCCC(/C=C/c1ccccc1OCCCCCBr)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H33BrO5/c28-18-6-1-7-19-33-25-10-4-3-9-23(25)15-12-21(8-2-5-11-26(29)30)20-22-13-16-24(17-14-22)27(31)32/h3-4,9-10,12-17,21H,1-2,5-8,11,18-20H2,(H,29,30)(H,31,32)/b15-12+ |
| InChIKey | GDGDUVBFMHCBDA-NTCAYCPXSA-N |
| XLogP | 6.85 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|