C35H44N4O5 — CID 59210769
4-[6-carboxy-2-[(E)-2-[2-[5-(4-pyrimidin-2-ylpiperazin-1-yl)pentoxy]phenyl]ethenyl]hexyl]benzoic acid (PubChem CID 59210769) has the molecular formula C35H44N4O5 and a molecular weight of 600.76 g/mol. Its IUPAC name is 4-[6-carboxy-2-[(E)-2-[2-[5-(4-pyrimidin-2-ylpiperazin-1-yl)pentoxy]phenyl]ethenyl]hexyl]benzoic acid.
| Compound Name | 4-[6-carboxy-2-[(E)-2-[2-[5-(4-pyrimidin-2-ylpiperazin-1-yl)pentoxy]phenyl]ethenyl]hexyl]benzoic acid |
|---|---|
| PubChem CID | 59210769 |
| Molecular Formula | C35H44N4O5 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | 4-[6-carboxy-2-[(E)-2-[2-[5-(4-pyrimidin-2-ylpiperazin-1-yl)pentoxy]phenyl]ethenyl]hexyl]benzoic acid |
| SMILES | O=C(O)CCCCC(/C=C/c1ccccc1OCCCCCN1CCN(c2ncccn2)CC1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C35H44N4O5/c40-33(41)12-5-2-9-28(27-29-14-17-31(18-15-29)34(42)43)13-16-30-10-3-4-11-32(30)44-26-7-1-6-21-38-22-24-39(25-23-38)35-36-19-8-20-37-35/h3-4,8,10-11,13-20,28H,1-2,5-7,9,12,21-27H2,(H,40,41)(H,42,43)/b16-13+ |
| InChIKey | GVAGIMJHJDDVAE-DTQAZKPQSA-N |
| XLogP | 6.06 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|