C34H41NO6 — CID 59210824
4-[6-carboxy-2-[(E)-2-[2-[5-(4-methoxyanilino)pentoxy]phenyl]ethenyl]hexyl]benzoic acid (PubChem CID 59210824) has the molecular formula C34H41NO6 and a molecular weight of 559.70 g/mol. Its IUPAC name is 4-[6-carboxy-2-[(E)-2-[2-[5-(4-methoxyanilino)pentoxy]phenyl]ethenyl]hexyl]benzoic acid.
| Compound Name | 4-[6-carboxy-2-[(E)-2-[2-[5-(4-methoxyanilino)pentoxy]phenyl]ethenyl]hexyl]benzoic acid |
|---|---|
| PubChem CID | 59210824 |
| Molecular Formula | C34H41NO6 |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | 4-[6-carboxy-2-[(E)-2-[2-[5-(4-methoxyanilino)pentoxy]phenyl]ethenyl]hexyl]benzoic acid |
| SMILES | COc1ccc(NCCCCCOc2ccccc2/C=C/C(CCCCC(=O)O)Cc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C34H41NO6/c1-40-31-21-19-30(20-22-31)35-23-7-2-8-24-41-32-11-5-4-10-28(32)16-13-26(9-3-6-12-33(36)37)25-27-14-17-29(18-15-27)34(38)39/h4-5,10-11,13-22,26,35H,2-3,6-9,12,23-25H2,1H3,(H,36,37)(H,38,39)/b16-13+ |
| InChIKey | QMJUCYJXFOZPDM-DTQAZKPQSA-N |
| XLogP | 7.57 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|