C29H39NO5 — CID 59210586
4-[6-carboxy-2-[(E)-2-[2-[5-(dimethylamino)pentoxy]phenyl]ethenyl]hexyl]benzoic acid (PubChem CID 59210586) has the molecular formula C29H39NO5 and a molecular weight of 481.63 g/mol. Its IUPAC name is 4-[6-carboxy-2-[(E)-2-[2-[5-(dimethylamino)pentoxy]phenyl]ethenyl]hexyl]benzoic acid.
| Compound Name | 4-[6-carboxy-2-[(E)-2-[2-[5-(dimethylamino)pentoxy]phenyl]ethenyl]hexyl]benzoic acid |
|---|---|
| PubChem CID | 59210586 |
| Molecular Formula | C29H39NO5 |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 4-[6-carboxy-2-[(E)-2-[2-[5-(dimethylamino)pentoxy]phenyl]ethenyl]hexyl]benzoic acid |
| SMILES | CN(C)CCCCCOc1ccccc1/C=C/C(CCCCC(=O)O)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C29H39NO5/c1-30(2)20-8-3-9-21-35-27-12-6-5-11-25(27)17-14-23(10-4-7-13-28(31)32)22-24-15-18-26(19-16-24)29(33)34/h5-6,11-12,14-19,23H,3-4,7-10,13,20-22H2,1-2H3,(H,31,32)(H,33,34)/b17-14+ |
| InChIKey | GWJQCGCNVQVLOW-SAPNQHFASA-N |
| XLogP | 6.01 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|