C42H49NO5 — CID 72531533
methyl 4-[2-[2-[benzyl-(2-ethoxy-2-oxoethyl)amino]ethyl]-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoate (PubChem CID 72531533) has the molecular formula C42H49NO5 and a molecular weight of 647.86 g/mol. Its IUPAC name is methyl 4-[2-[2-[benzyl-(2-ethoxy-2-oxoethyl)amino]ethyl]-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoate.
| Compound Name | methyl 4-[2-[2-[benzyl-(2-ethoxy-2-oxoethyl)amino]ethyl]-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoate |
|---|---|
| PubChem CID | 72531533 |
| Molecular Formula | C42H49NO5 |
| Molecular Weight | 647.86 g/mol |
| Exact Mass | 647.36 |
| IUPAC Name | methyl 4-[2-[2-[benzyl-(2-ethoxy-2-oxoethyl)amino]ethyl]-4-[2-(5-phenylpentoxy)phenyl]but-3-enyl]benzoate |
| SMILES | CCOC(=O)CN(CCC(C=Cc1ccccc1OCCCCCc1ccccc1)Cc1ccc(C(=O)OC)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C42H49NO5/c1-3-47-41(44)33-43(32-37-18-9-5-10-19-37)29-28-36(31-35-23-26-39(27-24-35)42(45)46-2)22-25-38-20-12-13-21-40(38)48-30-14-6-11-17-34-15-7-4-8-16-34/h4-5,7-10,12-13,15-16,18-27,36H,3,6,11,14,17,28-33H2,1-2H3 |
| InChIKey | OJECSANHNFOYED-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.86 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|