C34H42N2O6 — CID 23546401
methyl 4-[[[2-[(2-ethoxy-2-oxoethyl)amino]-2-oxoethyl]-[2-[2-(5-phenylpentoxy)phenyl]ethyl]amino]methyl]benzoate (PubChem CID 23546401) has the molecular formula C34H42N2O6 and a molecular weight of 574.72 g/mol. Its IUPAC name is methyl 4-[[[2-[(2-ethoxy-2-oxoethyl)amino]-2-oxoethyl]-[2-[2-(5-phenylpentoxy)phenyl]ethyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[(2-ethoxy-2-oxoethyl)amino]-2-oxoethyl]-[2-[2-(5-phenylpentoxy)phenyl]ethyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 23546401 |
| Molecular Formula | C34H42N2O6 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | methyl 4-[[[2-[(2-ethoxy-2-oxoethyl)amino]-2-oxoethyl]-[2-[2-(5-phenylpentoxy)phenyl]ethyl]amino]methyl]benzoate |
| SMILES | CCOC(=O)CNC(=O)CN(CCc1ccccc1OCCCCCc1ccccc1)Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C34H42N2O6/c1-3-41-33(38)24-35-32(37)26-36(25-28-17-19-30(20-18-28)34(39)40-2)22-21-29-15-9-10-16-31(29)42-23-11-5-8-14-27-12-6-4-7-13-27/h4,6-7,9-10,12-13,15-20H,3,5,8,11,14,21-26H2,1-2H3,(H,35,37) |
| InChIKey | QLEATAPHTBMDRU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|