C30H43NO5 — CID 142049583
methyl 4-[[(5-ethoxy-5-oxopentyl)-[2-(2-hexoxyphenyl)ethyl]amino]methyl]benzoate (PubChem CID 142049583) has the molecular formula C30H43NO5 and a molecular weight of 497.68 g/mol. Its IUPAC name is methyl 4-[[(5-ethoxy-5-oxopentyl)-[2-(2-hexoxyphenyl)ethyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[(5-ethoxy-5-oxopentyl)-[2-(2-hexoxyphenyl)ethyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 142049583 |
| Molecular Formula | C30H43NO5 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | methyl 4-[[(5-ethoxy-5-oxopentyl)-[2-(2-hexoxyphenyl)ethyl]amino]methyl]benzoate |
| SMILES | CCCCCCOc1ccccc1CCN(CCCCC(=O)OCC)Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C30H43NO5/c1-4-6-7-12-23-36-28-14-9-8-13-26(28)20-22-31(21-11-10-15-29(32)35-5-2)24-25-16-18-27(19-17-25)30(33)34-3/h8-9,13-14,16-19H,4-7,10-12,15,20-24H2,1-3H3 |
| InChIKey | HLFXIRFXBNZKQY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|