C25H33NO5 — CID 91547880
methyl 4-[[(5-ethoxy-5-oxopentyl)-(2-methoxy-2-phenylethyl)amino]methyl]benzoate (PubChem CID 91547880) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is methyl 4-[[(5-ethoxy-5-oxopentyl)-(2-methoxy-2-phenylethyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[(5-ethoxy-5-oxopentyl)-(2-methoxy-2-phenylethyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 91547880 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | methyl 4-[[(5-ethoxy-5-oxopentyl)-(2-methoxy-2-phenylethyl)amino]methyl]benzoate |
| SMILES | CCOC(=O)CCCCN(Cc1ccc(C(=O)OC)cc1)CC(OC)c1ccccc1 |
| InChI | InChI=1S/C25H33NO5/c1-4-31-24(27)12-8-9-17-26(19-23(29-2)21-10-6-5-7-11-21)18-20-13-15-22(16-14-20)25(28)30-3/h5-7,10-11,13-16,23H,4,8-9,12,17-19H2,1-3H3 |
| InChIKey | UDMDMXOUMQKSBQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|