C24H31NO4 — CID 144830109
4-[[(2-ethoxy-2-phenylethyl)-(5-oxohexyl)amino]methyl]benzoic acid (PubChem CID 144830109) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-[[(2-ethoxy-2-phenylethyl)-(5-oxohexyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(2-ethoxy-2-phenylethyl)-(5-oxohexyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 144830109 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 4-[[(2-ethoxy-2-phenylethyl)-(5-oxohexyl)amino]methyl]benzoic acid |
| SMILES | CCOC(CN(CCCCC(C)=O)Cc1ccc(C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO4/c1-3-29-23(21-10-5-4-6-11-21)18-25(16-8-7-9-19(2)26)17-20-12-14-22(15-13-20)24(27)28/h4-6,10-15,23H,3,7-9,16-18H2,1-2H3,(H,27,28) |
| InChIKey | VTIZDTHWWNIIJV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|