C35H55N3O6S2 — CID 159999660
[(2S)-1-[4-[[(2S)-4-acetamido-2-acetyloxybutyl]-benzylamino]butyl-benzylamino]-6-oxoheptan-2-yl] acetate;sulfane (PubChem CID 159999660) has the molecular formula C35H55N3O6S2 and a molecular weight of 677.97 g/mol. Its IUPAC name is [(2S)-1-[4-[[(2S)-4-acetamido-2-acetyloxybutyl]-benzylamino]butyl-benzylamino]-6-oxoheptan-2-yl] acetate;sulfane.
| Compound Name | [(2S)-1-[4-[[(2S)-4-acetamido-2-acetyloxybutyl]-benzylamino]butyl-benzylamino]-6-oxoheptan-2-yl] acetate;sulfane |
|---|---|
| PubChem CID | 159999660 |
| Molecular Formula | C35H55N3O6S2 |
| Molecular Weight | 677.97 g/mol |
| Exact Mass | 677.35 |
| IUPAC Name | [(2S)-1-[4-[[(2S)-4-acetamido-2-acetyloxybutyl]-benzylamino]butyl-benzylamino]-6-oxoheptan-2-yl] acetate;sulfane |
| SMILES | CC(=O)CCC[C@@H](CN(CCCCN(Cc1ccccc1)C[C@H](CCNC(C)=O)OC(C)=O)Cc1ccccc1)OC(C)=O.S.S |
| InChI | InChI=1S/C35H51N3O6.2H2S/c1-28(39)14-13-19-34(43-30(3)41)26-37(24-32-15-7-5-8-16-32)22-11-12-23-38(25-33-17-9-6-10-18-33)27-35(44-31(4)42)20-21-36-29(2)40;;/h5-10,15-18,34-35H,11-14,19-27H2,1-4H3,(H,36,40);2*1H2/t34-,35-;;/m0../s1 |
| InChIKey | OHZRBYYGPXTYHE-CZZKCPPWSA-N |
| XLogP | 5.15 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.97 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|