C18H28ClNO3 — CID 18338425
methyl 6-[benzyl-(3-chloro-2-hydroxypropyl)amino]-2-methylhexanoate (PubChem CID 18338425) has the molecular formula C18H28ClNO3 and a molecular weight of 341.88 g/mol. Its IUPAC name is methyl 6-[benzyl-(3-chloro-2-hydroxypropyl)amino]-2-methylhexanoate.
| Compound Name | methyl 6-[benzyl-(3-chloro-2-hydroxypropyl)amino]-2-methylhexanoate |
|---|---|
| PubChem CID | 18338425 |
| Molecular Formula | C18H28ClNO3 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | methyl 6-[benzyl-(3-chloro-2-hydroxypropyl)amino]-2-methylhexanoate |
| SMILES | COC(=O)C(C)CCCCN(Cc1ccccc1)CC(O)CCl |
| InChI | InChI=1S/C18H28ClNO3/c1-15(18(22)23-2)8-6-7-11-20(14-17(21)12-19)13-16-9-4-3-5-10-16/h3-5,9-10,15,17,21H,6-8,11-14H2,1-2H3 |
| InChIKey | OVKAECXGGWFOOU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|