C37H38N2O5 — CID 140738392
4-[[4-carboxybutyl-[(2R)-2-(3-isocyanophenyl)-2-[[4-(2-phenylethyl)phenyl]methoxy]ethyl]amino]methyl]benzoic acid (PubChem CID 140738392) has the molecular formula C37H38N2O5 and a molecular weight of 590.72 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[(2R)-2-(3-isocyanophenyl)-2-[[4-(2-phenylethyl)phenyl]methoxy]ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-carboxybutyl-[(2R)-2-(3-isocyanophenyl)-2-[[4-(2-phenylethyl)phenyl]methoxy]ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 140738392 |
| Molecular Formula | C37H38N2O5 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 4-[[4-carboxybutyl-[(2R)-2-(3-isocyanophenyl)-2-[[4-(2-phenylethyl)phenyl]methoxy]ethyl]amino]methyl]benzoic acid |
| SMILES | [C-]#[N+]c1cccc([C@H](CN(CCCCC(=O)O)Cc2ccc(C(=O)O)cc2)OCc2ccc(CCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C37H38N2O5/c1-38-34-11-7-10-33(24-34)35(44-27-31-17-15-29(16-18-31)14-13-28-8-3-2-4-9-28)26-39(23-6-5-12-36(40)41)25-30-19-21-32(22-20-30)37(42)43/h2-4,7-11,15-22,24,35H,5-6,12-14,23,25-27H2,(H,40,41)(H,42,43)/t35-/m0/s1 |
| InChIKey | PZMSSZBGLLJHAK-DHUJRADRSA-N |
| XLogP | 7.74 |
| TPSA | 91.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|