C34H35NO5S — CID 23546295
4-[[4-carboxybutyl-[2-[2-[(4-phenylsulfanylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid (PubChem CID 23546295) has the molecular formula C34H35NO5S and a molecular weight of 569.72 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[2-[2-[(4-phenylsulfanylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-carboxybutyl-[2-[2-[(4-phenylsulfanylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 23546295 |
| Molecular Formula | C34H35NO5S |
| Molecular Weight | 569.72 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 4-[[4-carboxybutyl-[2-[2-[(4-phenylsulfanylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)CCCCN(CCc1ccccc1OCc1ccc(Sc2ccccc2)cc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C34H35NO5S/c36-33(37)12-6-7-22-35(24-26-13-17-29(18-14-26)34(38)39)23-21-28-8-4-5-11-32(28)40-25-27-15-19-31(20-16-27)41-30-9-2-1-3-10-30/h1-5,8-11,13-20H,6-7,12,21-25H2,(H,36,37)(H,38,39) |
| InChIKey | JKYCWLCAUIVQRZ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.72 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|