C34H33ClFNO5 — CID 10188686
4-[[4-carboxybutyl-[2-[2-[[2-chloro-4-(4-fluorophenyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid (PubChem CID 10188686) has the molecular formula C34H33ClFNO5 and a molecular weight of 590.09 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[2-[2-[[2-chloro-4-(4-fluorophenyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-carboxybutyl-[2-[2-[[2-chloro-4-(4-fluorophenyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 10188686 |
| Molecular Formula | C34H33ClFNO5 |
| Molecular Weight | 590.09 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | 4-[[4-carboxybutyl-[2-[2-[[2-chloro-4-(4-fluorophenyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)CCCCN(CCc1ccccc1OCc1ccc(-c2ccc(F)cc2)cc1Cl)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C34H33ClFNO5/c35-31-21-28(25-14-16-30(36)17-15-25)12-13-29(31)23-42-32-6-2-1-5-26(32)18-20-37(19-4-3-7-33(38)39)22-24-8-10-27(11-9-24)34(40)41/h1-2,5-6,8-17,21H,3-4,7,18-20,22-23H2,(H,38,39)(H,40,41) |
| InChIKey | PFQHKFIRINNJRD-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.09 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|