C29H30F3NO5S — CID 23546299
4-[[4-carboxybutyl-[2-[2-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid (PubChem CID 23546299) has the molecular formula C29H30F3NO5S and a molecular weight of 561.62 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[2-[2-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-carboxybutyl-[2-[2-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 23546299 |
| Molecular Formula | C29H30F3NO5S |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 4-[[4-carboxybutyl-[2-[2-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)CCCCN(CCc1ccccc1OCc1ccc(SC(F)(F)F)cc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C29H30F3NO5S/c30-29(31,32)39-25-14-10-22(11-15-25)20-38-26-6-2-1-5-23(26)16-18-33(17-4-3-7-27(34)35)19-21-8-12-24(13-9-21)28(36)37/h1-2,5-6,8-15H,3-4,7,16-20H2,(H,34,35)(H,36,37) |
| InChIKey | AELXZDUBNLEUQA-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|