C34H36N2O5 — CID 23546284
4-[[4-carboxybutyl-[2-[2-[[4-(5-methyl-2-pyridinyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid (PubChem CID 23546284) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[2-[2-[[4-(5-methyl-2-pyridinyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-carboxybutyl-[2-[2-[[4-(5-methyl-2-pyridinyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 23546284 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 4-[[4-carboxybutyl-[2-[2-[[4-(5-methyl-2-pyridinyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
| SMILES | Cc1ccc(-c2ccc(COc3ccccc3CCN(CCCCC(=O)O)Cc3ccc(C(=O)O)cc3)cc2)nc1 |
| InChI | InChI=1S/C34H36N2O5/c1-25-9-18-31(35-22-25)28-14-12-27(13-15-28)24-41-32-7-3-2-6-29(32)19-21-36(20-5-4-8-33(37)38)23-26-10-16-30(17-11-26)34(39)40/h2-3,6-7,9-18,22H,4-5,8,19-21,23-24H2,1H3,(H,37,38)(H,39,40) |
| InChIKey | HWTLUYYMDSFXGD-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|