C35H35NO5 — CID 74061629
4-[[4-carboxybutyl-[[2-[[4-(2-phenylethenyl)phenyl]methoxy]phenyl]methyl]amino]methyl]benzoic acid (PubChem CID 74061629) has the molecular formula C35H35NO5 and a molecular weight of 549.67 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[[2-[[4-(2-phenylethenyl)phenyl]methoxy]phenyl]methyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-carboxybutyl-[[2-[[4-(2-phenylethenyl)phenyl]methoxy]phenyl]methyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 74061629 |
| Molecular Formula | C35H35NO5 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | 4-[[4-carboxybutyl-[[2-[[4-(2-phenylethenyl)phenyl]methoxy]phenyl]methyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)CCCCN(Cc1ccc(C(=O)O)cc1)Cc1ccccc1OCc1ccc(C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C35H35NO5/c37-34(38)12-6-7-23-36(24-29-19-21-31(22-20-29)35(39)40)25-32-10-4-5-11-33(32)41-26-30-17-15-28(16-18-30)14-13-27-8-2-1-3-9-27/h1-5,8-11,13-22H,6-7,12,23-26H2,(H,37,38)(H,39,40) |
| InChIKey | KVFFVFJFTNUWRM-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|