C34H30F5NO5 — CID 10304649
4-[[4-carboxybutyl-[[2-[difluoro-[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]methyl]amino]methyl]benzoic acid (PubChem CID 10304649) has the molecular formula C34H30F5NO5 and a molecular weight of 627.61 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[[2-[difluoro-[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]methyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-carboxybutyl-[[2-[difluoro-[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]methyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 10304649 |
| Molecular Formula | C34H30F5NO5 |
| Molecular Weight | 627.61 g/mol |
| Exact Mass | 627.20 |
| IUPAC Name | 4-[[4-carboxybutyl-[[2-[difluoro-[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]methyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)CCCCN(Cc1ccc(C(=O)O)cc1)Cc1ccccc1OC(F)(F)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C34H30F5NO5/c35-33(36,37)28-16-12-24(13-17-28)25-14-18-29(19-15-25)34(38,39)45-30-6-2-1-5-27(30)22-40(20-4-3-7-31(41)42)21-23-8-10-26(11-9-23)32(43)44/h1-2,5-6,8-19H,3-4,7,20-22H2,(H,41,42)(H,43,44) |
| InChIKey | LJZMJVAHCPACLB-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.61 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|