C35H37NO5 — CID 23546313
4-[[5-carboxypentyl-[2-[2-[(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid (PubChem CID 23546313) has the molecular formula C35H37NO5 and a molecular weight of 551.68 g/mol. Its IUPAC name is 4-[[5-carboxypentyl-[2-[2-[(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[5-carboxypentyl-[2-[2-[(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 23546313 |
| Molecular Formula | C35H37NO5 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 4-[[5-carboxypentyl-[2-[2-[(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)CCCCCN(CCc1ccccc1OCc1ccc(-c2ccccc2)cc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C35H37NO5/c37-34(38)13-5-2-8-23-36(25-27-14-20-32(21-15-27)35(39)40)24-22-31-11-6-7-12-33(31)41-26-28-16-18-30(19-17-28)29-9-3-1-4-10-29/h1,3-4,6-7,9-12,14-21H,2,5,8,13,22-26H2,(H,37,38)(H,39,40) |
| InChIKey | XOSHMNRSQBOESY-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|