C34H34ClF2NO5 — CID 69244469
4-[[4-carboxybutyl-[2-[2-[difluoro-(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid;hydrochloride (PubChem CID 69244469) has the molecular formula C34H34ClF2NO5 and a molecular weight of 610.10 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[2-[2-[difluoro-(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[4-carboxybutyl-[2-[2-[difluoro-(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 69244469 |
| Molecular Formula | C34H34ClF2NO5 |
| Molecular Weight | 610.10 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | 4-[[4-carboxybutyl-[2-[2-[difluoro-(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCCN(CCc1ccccc1OC(F)(F)c1ccc(-c2ccccc2)cc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C34H33F2NO5.ClH/c35-34(36,30-19-17-27(18-20-30)26-8-2-1-3-9-26)42-31-11-5-4-10-28(31)21-23-37(22-7-6-12-32(38)39)24-25-13-15-29(16-14-25)33(40)41;/h1-5,8-11,13-20H,6-7,12,21-24H2,(H,38,39)(H,40,41);1H |
| InChIKey | UXOWKLIYAFHQJM-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.10 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|