C37H41NO5 — CID 23546279
4-[[4-carboxybutyl-[2-[2-[[4-(4-propylphenyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid (PubChem CID 23546279) has the molecular formula C37H41NO5 and a molecular weight of 579.74 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[2-[2-[[4-(4-propylphenyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-carboxybutyl-[2-[2-[[4-(4-propylphenyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 23546279 |
| Molecular Formula | C37H41NO5 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | 4-[[4-carboxybutyl-[2-[2-[[4-(4-propylphenyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
| SMILES | CCCc1ccc(-c2ccc(COc3ccccc3CCN(CCCCC(=O)O)Cc3ccc(C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H41NO5/c1-2-7-28-11-17-31(18-12-28)32-19-15-30(16-20-32)27-43-35-9-4-3-8-33(35)23-25-38(24-6-5-10-36(39)40)26-29-13-21-34(22-14-29)37(41)42/h3-4,8-9,11-22H,2,5-7,10,23-27H2,1H3,(H,39,40)(H,41,42) |
| InChIKey | SJWODYAJJWPHIE-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|