C37H41NO4 — CID 23546365
methyl 2-[4-[[5-oxohexyl-[2-[2-[(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]phenyl]acetate (PubChem CID 23546365) has the molecular formula C37H41NO4 and a molecular weight of 563.74 g/mol. Its IUPAC name is methyl 2-[4-[[5-oxohexyl-[2-[2-[(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]phenyl]acetate.
| Compound Name | methyl 2-[4-[[5-oxohexyl-[2-[2-[(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 23546365 |
| Molecular Formula | C37H41NO4 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | methyl 2-[4-[[5-oxohexyl-[2-[2-[(4-phenylphenyl)methoxy]phenyl]ethyl]amino]methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(CN(CCCCC(C)=O)CCc2ccccc2OCc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H41NO4/c1-29(39)10-8-9-24-38(27-31-17-15-30(16-18-31)26-37(40)41-2)25-23-35-13-6-7-14-36(35)42-28-32-19-21-34(22-20-32)33-11-4-3-5-12-33/h3-7,11-22H,8-10,23-28H2,1-2H3 |
| InChIKey | IXNITQUWXDNANN-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|