C37H40ClFN2O5 — CID 142049599
methyl 4-[[2-[2-[[4-(3-chloro-4-fluorophenyl)phenyl]methoxy]phenyl]ethyl-[5-(methylaminomethoxy)-5-oxopentyl]amino]methyl]benzoate (PubChem CID 142049599) has the molecular formula C37H40ClFN2O5 and a molecular weight of 647.19 g/mol. Its IUPAC name is methyl 4-[[2-[2-[[4-(3-chloro-4-fluorophenyl)phenyl]methoxy]phenyl]ethyl-[5-(methylaminomethoxy)-5-oxopentyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[2-[2-[[4-(3-chloro-4-fluorophenyl)phenyl]methoxy]phenyl]ethyl-[5-(methylaminomethoxy)-5-oxopentyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 142049599 |
| Molecular Formula | C37H40ClFN2O5 |
| Molecular Weight | 647.19 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | methyl 4-[[2-[2-[[4-(3-chloro-4-fluorophenyl)phenyl]methoxy]phenyl]ethyl-[5-(methylaminomethoxy)-5-oxopentyl]amino]methyl]benzoate |
| SMILES | CNCOC(=O)CCCCN(CCc1ccccc1OCc1ccc(-c2ccc(F)c(Cl)c2)cc1)Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C37H40ClFN2O5/c1-40-26-46-36(42)9-5-6-21-41(24-27-10-16-31(17-11-27)37(43)44-2)22-20-30-7-3-4-8-35(30)45-25-28-12-14-29(15-13-28)32-18-19-34(39)33(38)23-32/h3-4,7-8,10-19,23,40H,5-6,9,20-22,24-26H2,1-2H3 |
| InChIKey | CMJKMDPFTIHWTH-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.19 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|