C36H37F2NO3 — CID 59621417
6-[(4-acetylphenyl)methyl-[2-[2-[[4-(2,3-difluorophenyl)phenyl]methoxy]phenyl]ethyl]amino]hexan-2-one (PubChem CID 59621417) has the molecular formula C36H37F2NO3 and a molecular weight of 569.69 g/mol. Its IUPAC name is 6-[(4-acetylphenyl)methyl-[2-[2-[[4-(2,3-difluorophenyl)phenyl]methoxy]phenyl]ethyl]amino]hexan-2-one.
| Compound Name | 6-[(4-acetylphenyl)methyl-[2-[2-[[4-(2,3-difluorophenyl)phenyl]methoxy]phenyl]ethyl]amino]hexan-2-one |
|---|---|
| PubChem CID | 59621417 |
| Molecular Formula | C36H37F2NO3 |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | 6-[(4-acetylphenyl)methyl-[2-[2-[[4-(2,3-difluorophenyl)phenyl]methoxy]phenyl]ethyl]amino]hexan-2-one |
| SMILES | CC(=O)CCCCN(CCc1ccccc1OCc1ccc(-c2cccc(F)c2F)cc1)Cc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C36H37F2NO3/c1-26(40)8-5-6-22-39(24-28-13-17-30(18-14-28)27(2)41)23-21-32-9-3-4-12-35(32)42-25-29-15-19-31(20-16-29)33-10-7-11-34(37)36(33)38/h3-4,7,9-20H,5-6,8,21-25H2,1-2H3 |
| InChIKey | AAAMELLFPWXPQY-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|