C32H38BrNO5 — CID 68782214
methyl 4-[2-[2-[2-[(4-bromophenyl)methoxy]phenyl]ethyl-(5-ethoxy-5-oxopentyl)amino]ethyl]benzoate (PubChem CID 68782214) has the molecular formula C32H38BrNO5 and a molecular weight of 596.56 g/mol. Its IUPAC name is methyl 4-[2-[2-[2-[(4-bromophenyl)methoxy]phenyl]ethyl-(5-ethoxy-5-oxopentyl)amino]ethyl]benzoate.
| Compound Name | methyl 4-[2-[2-[2-[(4-bromophenyl)methoxy]phenyl]ethyl-(5-ethoxy-5-oxopentyl)amino]ethyl]benzoate |
|---|---|
| PubChem CID | 68782214 |
| Molecular Formula | C32H38BrNO5 |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | methyl 4-[2-[2-[2-[(4-bromophenyl)methoxy]phenyl]ethyl-(5-ethoxy-5-oxopentyl)amino]ethyl]benzoate |
| SMILES | CCOC(=O)CCCCN(CCc1ccc(C(=O)OC)cc1)CCc1ccccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C32H38BrNO5/c1-3-38-31(35)10-6-7-21-34(22-19-25-11-15-28(16-12-25)32(36)37-2)23-20-27-8-4-5-9-30(27)39-24-26-13-17-29(33)18-14-26/h4-5,8-9,11-18H,3,6-7,10,19-24H2,1-2H3 |
| InChIKey | RHASXGNNUWCZCB-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|