C22H29NO3 — CID 20544947
methyl 4-[2-[2-[4-(dimethylamino)butoxy]phenyl]ethyl]benzoate (PubChem CID 20544947) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is methyl 4-[2-[2-[4-(dimethylamino)butoxy]phenyl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[2-[4-(dimethylamino)butoxy]phenyl]ethyl]benzoate |
|---|---|
| PubChem CID | 20544947 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | methyl 4-[2-[2-[4-(dimethylamino)butoxy]phenyl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCc2ccccc2OCCCCN(C)C)cc1 |
| InChI | InChI=1S/C22H29NO3/c1-23(2)16-6-7-17-26-21-9-5-4-8-19(21)13-10-18-11-14-20(15-12-18)22(24)25-3/h4-5,8-9,11-12,14-15H,6-7,10,13,16-17H2,1-3H3 |
| InChIKey | VFGPVZRHLGGFPI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|